C8H11ClN2O — CID 12800072
2-chloro-N-(2,5-dimethylpyrrol-1-yl)acetamide (PubChem CID 12800072) has the molecular formula C8H11ClN2O and a molecular weight of 186.64 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylpyrrol-1-yl)acetamide.
| Compound Name | 2-chloro-N-(2,5-dimethylpyrrol-1-yl)acetamide |
|---|---|
| PubChem CID | 12800072 |
| Molecular Formula | C8H11ClN2O |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylpyrrol-1-yl)acetamide |
| SMILES | Cc1ccc(C)n1NC(=O)CCl |
| InChI | InChI=1S/C8H11ClN2O/c1-6-3-4-7(2)11(6)10-8(12)5-9/h3-4H,5H2,1-2H3,(H,10,12) |
| InChIKey | VBHAZOCHCHKCNG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|