C11H19N3O — CID 79101397
5-amino-N-(2,5-dimethylpyrrol-1-yl)pentanamide (PubChem CID 79101397) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-amino-N-(2,5-dimethylpyrrol-1-yl)pentanamide.
| Compound Name | 5-amino-N-(2,5-dimethylpyrrol-1-yl)pentanamide |
|---|---|
| PubChem CID | 79101397 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-amino-N-(2,5-dimethylpyrrol-1-yl)pentanamide |
| SMILES | Cc1ccc(C)n1NC(=O)CCCCN |
| InChI | InChI=1S/C11H19N3O/c1-9-6-7-10(2)14(9)13-11(15)5-3-4-8-12/h6-7H,3-5,8,12H2,1-2H3,(H,13,15) |
| InChIKey | YLPNAGCFFULWFU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|