About N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine
N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine (PubChem CID 79101247) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine.
Analyze N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine?
The IUPAC name of N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine (CID 79101247) is N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine.
What is the SMILES notation for N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine?
The canonical SMILES for N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine is CCn1ncnc1CNn1cccc1.
What is the InChIKey of N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine?
The InChIKey is JUVNIFADEBHRQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5/c1-2-14-9(10-8-12-14)7-11-13-5-3-4-6-13/h3-6,8,11H,2,7H2,1H3.
What are the key properties of N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine?
N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine has a molecular weight of 191.24 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]pyrrol-1-amine is sourced from PubChem (CID 79101247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).