C15H19BrN2 — CID 79102060
1-[1-[(4-bromophenyl)methyl]pyrrol-2-yl]-N-ethylethanamine (PubChem CID 79102060) has the molecular formula C15H19BrN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-[1-[(4-bromophenyl)methyl]pyrrol-2-yl]-N-ethylethanamine.
| Compound Name | 1-[1-[(4-bromophenyl)methyl]pyrrol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 79102060 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-[1-[(4-bromophenyl)methyl]pyrrol-2-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1cccn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2/c1-3-17-12(2)15-5-4-10-18(15)11-13-6-8-14(16)9-7-13/h4-10,12,17H,3,11H2,1-2H3 |
| InChIKey | AZOSBILWMKEUEL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |