C15H22N2S — CID 79102565
N-ethyl-1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-2-yl]ethanamine (PubChem CID 79102565) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-ethyl-1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-2-yl]ethanamine.
| Compound Name | N-ethyl-1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-2-yl]ethanamine |
|---|---|
| PubChem CID | 79102565 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-ethyl-1-[1-[(5-ethylthiophen-2-yl)methyl]pyrrol-2-yl]ethanamine |
| SMILES | CCNC(C)c1cccn1Cc1ccc(CC)s1 |
| InChI | InChI=1S/C15H22N2S/c1-4-13-8-9-14(18-13)11-17-10-6-7-15(17)12(3)16-5-2/h6-10,12,16H,4-5,11H2,1-3H3 |
| InChIKey | MQFPOWPSSONNQD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |