C11H18N2O2 — CID 79102812
4-[3-(1-hydroxyethyl)pyrrol-1-yl]-N-methylbutanamide (PubChem CID 79102812) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-[3-(1-hydroxyethyl)pyrrol-1-yl]-N-methylbutanamide.
| Compound Name | 4-[3-(1-hydroxyethyl)pyrrol-1-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 79102812 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-[3-(1-hydroxyethyl)pyrrol-1-yl]-N-methylbutanamide |
| SMILES | CNC(=O)CCCn1ccc(C(C)O)c1 |
| InChI | InChI=1S/C11H18N2O2/c1-9(14)10-5-7-13(8-10)6-3-4-11(15)12-2/h5,7-9,14H,3-4,6H2,1-2H3,(H,12,15) |
| InChIKey | AZKFROWPDQTCQR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |