C14H25N3O — CID 79105157
4-[3-[1-(ethylamino)propyl]pyrrol-1-yl]-N-methylbutanamide (PubChem CID 79105157) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-[3-[1-(ethylamino)propyl]pyrrol-1-yl]-N-methylbutanamide.
| Compound Name | 4-[3-[1-(ethylamino)propyl]pyrrol-1-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 79105157 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-[3-[1-(ethylamino)propyl]pyrrol-1-yl]-N-methylbutanamide |
| SMILES | CCNC(CC)c1ccn(CCCC(=O)NC)c1 |
| InChI | InChI=1S/C14H25N3O/c1-4-13(16-5-2)12-8-10-17(11-12)9-6-7-14(18)15-3/h8,10-11,13,16H,4-7,9H2,1-3H3,(H,15,18) |
| InChIKey | CJLGRORCVDRAHP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |