C13H22N2O2 — CID 79104624
methyl 4-[3-[1-(methylamino)propyl]pyrrol-1-yl]butanoate (PubChem CID 79104624) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl 4-[3-[1-(methylamino)propyl]pyrrol-1-yl]butanoate.
| Compound Name | methyl 4-[3-[1-(methylamino)propyl]pyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 79104624 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | methyl 4-[3-[1-(methylamino)propyl]pyrrol-1-yl]butanoate |
| SMILES | CCC(NC)c1ccn(CCCC(=O)OC)c1 |
| InChI | InChI=1S/C13H22N2O2/c1-4-12(14-2)11-7-9-15(10-11)8-5-6-13(16)17-3/h7,9-10,12,14H,4-6,8H2,1-3H3 |
| InChIKey | GOBBUNPBTQJBSJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |