C13H21F3N2 — CID 113326680
N-ethyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]propan-1-amine (PubChem CID 113326680) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is N-ethyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]propan-1-amine.
| Compound Name | N-ethyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 113326680 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-ethyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]propan-1-amine |
| SMILES | CCNC(CC)c1ccn(CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H21F3N2/c1-3-12(17-4-2)11-6-9-18(10-11)8-5-7-13(14,15)16/h6,9-10,12,17H,3-5,7-8H2,1-2H3 |
| InChIKey | SGPKTJZWEFDQAA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |