C11H17F3N2 — CID 115515157
N-methyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]ethanamine (PubChem CID 115515157) has the molecular formula C11H17F3N2 and a molecular weight of 234.26 g/mol. Its IUPAC name is N-methyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]ethanamine.
| Compound Name | N-methyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 115515157 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | N-methyl-1-[1-(4,4,4-trifluorobutyl)pyrrol-3-yl]ethanamine |
| SMILES | CNC(C)c1ccn(CCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H17F3N2/c1-9(15-2)10-4-7-16(8-10)6-3-5-11(12,13)14/h4,7-9,15H,3,5-6H2,1-2H3 |
| InChIKey | JOQRDNVOVOUABJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |