C16H22N2 — CID 79098439
N-methyl-1-[1-(3-phenylpropyl)pyrrol-3-yl]ethanamine (PubChem CID 79098439) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-methyl-1-[1-(3-phenylpropyl)pyrrol-3-yl]ethanamine.
| Compound Name | N-methyl-1-[1-(3-phenylpropyl)pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 79098439 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-methyl-1-[1-(3-phenylpropyl)pyrrol-3-yl]ethanamine |
| SMILES | CNC(C)c1ccn(CCCc2ccccc2)c1 |
| InChI | InChI=1S/C16H22N2/c1-14(17-2)16-10-12-18(13-16)11-6-9-15-7-4-3-5-8-15/h3-5,7-8,10,12-14,17H,6,9,11H2,1-2H3 |
| InChIKey | CDVTZOLQTRKGFM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |