C14H23N — CID 61485141
N,3-dimethyl-6-phenylhexan-2-amine (PubChem CID 61485141) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is N,3-dimethyl-6-phenylhexan-2-amine.
| Compound Name | N,3-dimethyl-6-phenylhexan-2-amine |
|---|---|
| PubChem CID | 61485141 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,3-dimethyl-6-phenylhexan-2-amine |
| SMILES | CNC(C)C(C)CCCc1ccccc1 |
| InChI | InChI=1S/C14H23N/c1-12(13(2)15-3)8-7-11-14-9-5-4-6-10-14/h4-6,9-10,12-13,15H,7-8,11H2,1-3H3 |
| InChIKey | AFRUYOFWVPPNTO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |