C20H27N — CID 115849452
N-methyl-1,5-diphenylheptan-4-amine (PubChem CID 115849452) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is N-methyl-1,5-diphenylheptan-4-amine.
| Compound Name | N-methyl-1,5-diphenylheptan-4-amine |
|---|---|
| PubChem CID | 115849452 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-methyl-1,5-diphenylheptan-4-amine |
| SMILES | CCC(c1ccccc1)C(CCCc1ccccc1)NC |
| InChI | InChI=1S/C20H27N/c1-3-19(18-14-8-5-9-15-18)20(21-2)16-10-13-17-11-6-4-7-12-17/h4-9,11-12,14-15,19-21H,3,10,13,16H2,1-2H3 |
| InChIKey | ISYYFFYFIUWMLR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |