C26H30ClNO — CID 141033404
2-(methylaminomethyl)-1,3,6-triphenylhexan-1-one;hydrochloride (PubChem CID 141033404) has the molecular formula C26H30ClNO and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-(methylaminomethyl)-1,3,6-triphenylhexan-1-one;hydrochloride.
| Compound Name | 2-(methylaminomethyl)-1,3,6-triphenylhexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 141033404 |
| Molecular Formula | C26H30ClNO |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-(methylaminomethyl)-1,3,6-triphenylhexan-1-one;hydrochloride |
| SMILES | CNCC(C(=O)c1ccccc1)C(CCCc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C26H29NO.ClH/c1-27-20-25(26(28)23-17-9-4-10-18-23)24(22-15-7-3-8-16-22)19-11-14-21-12-5-2-6-13-21;/h2-10,12-13,15-18,24-25,27H,11,14,19-20H2,1H3;1H |
| InChIKey | FVIMCPQJIYOZDN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |