C14H11NO2S — CID 79103440
1-(1-benzothiophen-3-ylmethyl)pyrrole-3-carboxylic acid (PubChem CID 79103440) has the molecular formula C14H11NO2S and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-ylmethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-(1-benzothiophen-3-ylmethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79103440 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(1-benzothiophen-3-ylmethyl)pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(Cc2csc3ccccc23)c1 |
| InChI | InChI=1S/C14H11NO2S/c16-14(17)10-5-6-15(7-10)8-11-9-18-13-4-2-1-3-12(11)13/h1-7,9H,8H2,(H,16,17) |
| InChIKey | CIOBMYUAUWPNNG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |