C8H9N3O4 — CID 79103520
1-[2-(carbamoylamino)-2-oxoethyl]pyrrole-3-carboxylic acid (PubChem CID 79103520) has the molecular formula C8H9N3O4 and a molecular weight of 211.18 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)-2-oxoethyl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[2-(carbamoylamino)-2-oxoethyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79103520 |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 1-[2-(carbamoylamino)-2-oxoethyl]pyrrole-3-carboxylic acid |
| SMILES | NC(=O)NC(=O)Cn1ccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H9N3O4/c9-8(15)10-6(12)4-11-2-1-5(3-11)7(13)14/h1-3H,4H2,(H,13,14)(H3,9,10,12,15) |
| InChIKey | HWJZNIVRDMAFKI-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |