C12H12IN3O2 — CID 79106046
N-(4-iodo-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine (PubChem CID 79106046) has the molecular formula C12H12IN3O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is N-(4-iodo-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-(4-iodo-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79106046 |
| Molecular Formula | C12H12IN3O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(4-iodo-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1Nc1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12IN3O2/c1-8-3-4-9(2)15(8)14-11-6-5-10(13)7-12(11)16(17)18/h3-7,14H,1-2H3 |
| InChIKey | OGGVQZPIPXONQW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|