C12H12FN3O2 — CID 79107216
N-(5-fluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine (PubChem CID 79107216) has the molecular formula C12H12FN3O2 and a molecular weight of 249.25 g/mol. Its IUPAC name is N-(5-fluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-(5-fluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79107216 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-(5-fluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1Nc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12FN3O2/c1-8-3-4-9(2)15(8)14-11-7-10(13)5-6-12(11)16(17)18/h3-7,14H,1-2H3 |
| InChIKey | CLDQYINNVMSAKF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|