C12H11F2N3O2 — CID 115508009
N-(3,5-difluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine (PubChem CID 115508009) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.24 g/mol. Its IUPAC name is N-(3,5-difluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-(3,5-difluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 115508009 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-(3,5-difluoro-2-nitrophenyl)-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1Nc1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F2N3O2/c1-7-3-4-8(2)16(7)15-11-6-9(13)5-10(14)12(11)17(18)19/h3-6,15H,1-2H3 |
| InChIKey | XGSGOFYDWTVYQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|