C9H12BrNO — CID 79106752
1-[1-(2-bromoprop-2-enyl)pyrrol-3-yl]ethanol (PubChem CID 79106752) has the molecular formula C9H12BrNO and a molecular weight of 230.10 g/mol. Its IUPAC name is 1-[1-(2-bromoprop-2-enyl)pyrrol-3-yl]ethanol.
| Compound Name | 1-[1-(2-bromoprop-2-enyl)pyrrol-3-yl]ethanol |
|---|---|
| PubChem CID | 79106752 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 1-[1-(2-bromoprop-2-enyl)pyrrol-3-yl]ethanol |
| SMILES | C=C(Br)Cn1ccc(C(C)O)c1 |
| InChI | InChI=1S/C9H12BrNO/c1-7(10)5-11-4-3-9(6-11)8(2)12/h3-4,6,8,12H,1,5H2,2H3 |
| InChIKey | ANFYIMJYVHTRBP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |