C11H19F3N2O — CID 79112531
N-(4-aminocyclohexyl)-2,2,2-trifluoro-N-propylacetamide (PubChem CID 79112531) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2,2,2-trifluoro-N-propylacetamide.
| Compound Name | N-(4-aminocyclohexyl)-2,2,2-trifluoro-N-propylacetamide |
|---|---|
| PubChem CID | 79112531 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-2,2,2-trifluoro-N-propylacetamide |
| SMILES | CCCN(C(=O)C(F)(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C11H19F3N2O/c1-2-7-16(10(17)11(12,13)14)9-5-3-8(15)4-6-9/h8-9H,2-7,15H2,1H3 |
| InChIKey | WKKVWKKUWMQUIJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |