C11H13BrN2O2 — CID 79114684
5-bromo-1-(3-cyano-3-methylbutyl)pyrrole-3-carboxylic acid (PubChem CID 79114684) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 5-bromo-1-(3-cyano-3-methylbutyl)pyrrole-3-carboxylic acid.
| Compound Name | 5-bromo-1-(3-cyano-3-methylbutyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79114684 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-bromo-1-(3-cyano-3-methylbutyl)pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C#N)CCn1cc(C(=O)O)cc1Br |
| InChI | InChI=1S/C11H13BrN2O2/c1-11(2,7-13)3-4-14-6-8(10(15)16)5-9(14)12/h5-6H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | FWHMIIQBBVWTCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |