C10H11BrF3NO3 — CID 79114500
5-bromo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-3-carboxylic acid (PubChem CID 79114500) has the molecular formula C10H11BrF3NO3 and a molecular weight of 330.10 g/mol. Its IUPAC name is 5-bromo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-3-carboxylic acid.
| Compound Name | 5-bromo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79114500 |
| Molecular Formula | C10H11BrF3NO3 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 5-bromo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)n(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H11BrF3NO3/c11-8-4-7(9(16)17)5-15(8)2-1-3-18-6-10(12,13)14/h4-5H,1-3,6H2,(H,16,17) |
| InChIKey | FMJAQJJKZDYXMP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|