C15H29N3O3 — CID 79114779
methyl 4-[[2-[(4-aminocyclohexyl)-ethylamino]acetyl]amino]butanoate (PubChem CID 79114779) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is methyl 4-[[2-[(4-aminocyclohexyl)-ethylamino]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(4-aminocyclohexyl)-ethylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 79114779 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | methyl 4-[[2-[(4-aminocyclohexyl)-ethylamino]acetyl]amino]butanoate |
| SMILES | CCN(CC(=O)NCCCC(=O)OC)C1CCC(N)CC1 |
| InChI | InChI=1S/C15H29N3O3/c1-3-18(13-8-6-12(16)7-9-13)11-14(19)17-10-4-5-15(20)21-2/h12-13H,3-11,16H2,1-2H3,(H,17,19) |
| InChIKey | ALSLACTZSQZRMP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|