C14H29N3O3 — CID 79668203
methyl 4-[[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]amino]butanoate (PubChem CID 79668203) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is methyl 4-[[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 79668203 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | methyl 4-[[2-[(3-amino-2,2-dimethylpropyl)-ethylamino]acetyl]amino]butanoate |
| SMILES | CCN(CC(=O)NCCCC(=O)OC)CC(C)(C)CN |
| InChI | InChI=1S/C14H29N3O3/c1-5-17(11-14(2,3)10-15)9-12(18)16-8-6-7-13(19)20-4/h5-11,15H2,1-4H3,(H,16,18) |
| InChIKey | GDBZLDJQSSQURB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|