C21H19N3O2 — CID 7911627
(E)-2-(1H-benzimidazol-2-yl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enenitrile (PubChem CID 7911627) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (E)-2-(1H-benzimidazol-2-yl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1H-benzimidazol-2-yl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 7911627 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (E)-2-(1H-benzimidazol-2-yl)-3-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]prop-2-enenitrile |
| SMILES | CCOc1cc2c(cc1/C=C(\C#N)c1nc3ccccc3[nH]1)O[C@H](C)C2 |
| InChI | InChI=1S/C21H19N3O2/c1-3-25-19-10-14-8-13(2)26-20(14)11-15(19)9-16(12-22)21-23-17-6-4-5-7-18(17)24-21/h4-7,9-11,13H,3,8H2,1-2H3,(H,23,24)/b16-9+/t13-/m1/s1 |
| InChIKey | WNTAVBXOFVUYDD-BPKVKKHESA-N |
| XLogP | 4.35 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|