C16H27N3O2 — CID 79118481
N-[1-(furan-2-yl)ethyl]-2-[methyl-[4-(methylamino)cyclohexyl]amino]acetamide (PubChem CID 79118481) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-2-[methyl-[4-(methylamino)cyclohexyl]amino]acetamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-2-[methyl-[4-(methylamino)cyclohexyl]amino]acetamide |
|---|---|
| PubChem CID | 79118481 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-2-[methyl-[4-(methylamino)cyclohexyl]amino]acetamide |
| SMILES | CNC1CCC(N(C)CC(=O)NC(C)c2ccco2)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-12(15-5-4-10-21-15)18-16(20)11-19(3)14-8-6-13(17-2)7-9-14/h4-5,10,12-14,17H,6-9,11H2,1-3H3,(H,18,20) |
| InChIKey | RHTDNEGWVBNVFA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |