C17H28N2O3 — CID 98761112
2-[cyclohexyl-[(2S)-2-hydroxypropyl]amino]-N-[(1R)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 98761112) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[cyclohexyl-[(2S)-2-hydroxypropyl]amino]-N-[(1R)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[cyclohexyl-[(2S)-2-hydroxypropyl]amino]-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 98761112 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-[cyclohexyl-[(2S)-2-hydroxypropyl]amino]-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@H](O)CN(CC(=O)N[C@H](C)c1ccco1)C1CCCCC1 |
| InChI | InChI=1S/C17H28N2O3/c1-13(20)11-19(15-7-4-3-5-8-15)12-17(21)18-14(2)16-9-6-10-22-16/h6,9-10,13-15,20H,3-5,7-8,11-12H2,1-2H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | VNLJBMSTFRHBDY-UONOGXRCSA-N |
| XLogP | 2.47 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |