C13H24N4 — CID 79119255
2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-propylazepane (PubChem CID 79119255) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-propylazepane.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-propylazepane |
|---|---|
| PubChem CID | 79119255 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2-propylazepane |
| SMILES | CCCC1(Cc2ncnn2C)CCCCCN1 |
| InChI | InChI=1S/C13H24N4/c1-3-7-13(8-5-4-6-9-15-13)10-12-14-11-16-17(12)2/h11,15H,3-10H2,1-2H3 |
| InChIKey | FLJPJSGXLBQNFB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |