C15H32N2 — CID 79123232
4-N-heptan-4-yl-1-N,4-N-dimethylcyclohexane-1,4-diamine (PubChem CID 79123232) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 4-N-heptan-4-yl-1-N,4-N-dimethylcyclohexane-1,4-diamine.
| Compound Name | 4-N-heptan-4-yl-1-N,4-N-dimethylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79123232 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 4-N-heptan-4-yl-1-N,4-N-dimethylcyclohexane-1,4-diamine |
| SMILES | CCCC(CCC)N(C)C1CCC(NC)CC1 |
| InChI | InChI=1S/C15H32N2/c1-5-7-14(8-6-2)17(4)15-11-9-13(16-3)10-12-15/h13-16H,5-12H2,1-4H3 |
| InChIKey | FFILTYNQYQUJHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |