C15H26F3NO — CID 79123952
1-[1-(aminomethyl)-3-ethylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79123952) has the molecular formula C15H26F3NO and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3-ethylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-3-ethylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79123952 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[1-(aminomethyl)-3-ethylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CCC1CCC(CN)(C2(O)CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C15H26F3NO/c1-2-11-3-6-13(9-11,10-19)14(20)7-4-12(5-8-14)15(16,17)18/h11-12,20H,2-10,19H2,1H3 |
| InChIKey | GAZHGDBUHWIVLE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |