C14H24F3NO — CID 79126439
1-[1-(aminomethyl)-3-methylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79126439) has the molecular formula C14H24F3NO and a molecular weight of 279.35 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3-methylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)-3-methylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79126439 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[1-(aminomethyl)-3-methylcyclopentyl]-4-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CC1CCC(CN)(C2(O)CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C14H24F3NO/c1-10-2-5-12(8-10,9-18)13(19)6-3-11(4-7-13)14(15,16)17/h10-11,19H,2-9,18H2,1H3 |
| InChIKey | HIBRDGAXUCVZHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |