C15H30N2O — CID 79135208
4-[1-(aminomethyl)-3-methylcyclopentyl]-1-propylpiperidin-4-ol (PubChem CID 79135208) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-3-methylcyclopentyl]-1-propylpiperidin-4-ol.
| Compound Name | 4-[1-(aminomethyl)-3-methylcyclopentyl]-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 79135208 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 4-[1-(aminomethyl)-3-methylcyclopentyl]-1-propylpiperidin-4-ol |
| SMILES | CCCN1CCC(O)(C2(CN)CCC(C)C2)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-3-8-17-9-6-15(18,7-10-17)14(12-16)5-4-13(2)11-14/h13,18H,3-12,16H2,1-2H3 |
| InChIKey | TWQCRHBFYDHRFP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |