C16H27NOS — CID 79124585
1-[1-(aminomethyl)-3-ethylcyclohexyl]-1-(3-methylthiophen-2-yl)ethanol (PubChem CID 79124585) has the molecular formula C16H27NOS and a molecular weight of 281.46 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-3-ethylcyclohexyl]-1-(3-methylthiophen-2-yl)ethanol.
| Compound Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-1-(3-methylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 79124585 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 1-[1-(aminomethyl)-3-ethylcyclohexyl]-1-(3-methylthiophen-2-yl)ethanol |
| SMILES | CCC1CCCC(CN)(C(C)(O)c2sccc2C)C1 |
| InChI | InChI=1S/C16H27NOS/c1-4-13-6-5-8-16(10-13,11-17)15(3,18)14-12(2)7-9-19-14/h7,9,13,18H,4-6,8,10-11,17H2,1-3H3 |
| InChIKey | NDBVOUATNJSMNU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |