C11H21NO2 — CID 79125297
2-[1-(aminomethyl)-3-ethylcyclopentyl]-2-hydroxypropanal (PubChem CID 79125297) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-3-ethylcyclopentyl]-2-hydroxypropanal.
| Compound Name | 2-[1-(aminomethyl)-3-ethylcyclopentyl]-2-hydroxypropanal |
|---|---|
| PubChem CID | 79125297 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-[1-(aminomethyl)-3-ethylcyclopentyl]-2-hydroxypropanal |
| SMILES | CCC1CCC(CN)(C(C)(O)C=O)C1 |
| InChI | InChI=1S/C11H21NO2/c1-3-9-4-5-11(6-9,7-12)10(2,14)8-13/h8-9,14H,3-7,12H2,1-2H3 |
| InChIKey | BEIPXCPQYGKDOT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|