C8H15NO4S — CID 115338626
2-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2-hydroxypropanal (PubChem CID 115338626) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2-hydroxypropanal.
| Compound Name | 2-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2-hydroxypropanal |
|---|---|
| PubChem CID | 115338626 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[3-(aminomethyl)-1,1-dioxothiolan-3-yl]-2-hydroxypropanal |
| SMILES | CC(O)(C=O)C1(CN)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H15NO4S/c1-7(11,5-10)8(4-9)2-3-14(12,13)6-8/h5,11H,2-4,6,9H2,1H3 |
| InChIKey | IAAWNFNEGFWCHI-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|