C15H31NO — CID 79135119
2-[1-(aminomethyl)-4-ethylcyclohexyl]-3-methylpentan-2-ol (PubChem CID 79135119) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-4-ethylcyclohexyl]-3-methylpentan-2-ol.
| Compound Name | 2-[1-(aminomethyl)-4-ethylcyclohexyl]-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 79135119 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2-[1-(aminomethyl)-4-ethylcyclohexyl]-3-methylpentan-2-ol |
| SMILES | CCC1CCC(CN)(C(C)(O)C(C)CC)CC1 |
| InChI | InChI=1S/C15H31NO/c1-5-12(3)14(4,17)15(11-16)9-7-13(6-2)8-10-15/h12-13,17H,5-11,16H2,1-4H3 |
| InChIKey | IOZGIKKFKNWWIX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |