C12H25NO — CID 79127868
2-[1-(aminomethyl)-3-methylcyclopentyl]-3-methylbutan-2-ol (PubChem CID 79127868) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-[1-(aminomethyl)-3-methylcyclopentyl]-3-methylbutan-2-ol.
| Compound Name | 2-[1-(aminomethyl)-3-methylcyclopentyl]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 79127868 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-[1-(aminomethyl)-3-methylcyclopentyl]-3-methylbutan-2-ol |
| SMILES | CC1CCC(CN)(C(C)(O)C(C)C)C1 |
| InChI | InChI=1S/C12H25NO/c1-9(2)11(4,14)12(8-13)6-5-10(3)7-12/h9-10,14H,5-8,13H2,1-4H3 |
| InChIKey | VXJAWDWGZJSJTL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |