C13H22F3NO — CID 79125401
1-[1-(aminomethyl)cyclopentyl]-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79125401) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclopentyl]-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-[1-(aminomethyl)cyclopentyl]-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79125401 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[1-(aminomethyl)cyclopentyl]-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | NCC1(C2(O)CCCC(C(F)(F)F)C2)CCCC1 |
| InChI | InChI=1S/C13H22F3NO/c14-13(15,16)10-4-3-7-12(18,8-10)11(9-17)5-1-2-6-11/h10,18H,1-9,17H2 |
| InChIKey | KNJVKWHQLQILMZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |