C11H20F3NO — CID 79126440
1-(1-aminobutan-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol (PubChem CID 79126440) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(1-aminobutan-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol.
| Compound Name | 1-(1-aminobutan-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79126440 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(1-aminobutan-2-yl)-3-(trifluoromethyl)cyclohexan-1-ol |
| SMILES | CCC(CN)C1(O)CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H20F3NO/c1-2-8(7-15)10(16)5-3-4-9(6-10)11(12,13)14/h8-9,16H,2-7,15H2,1H3 |
| InChIKey | QMZCJISMWAQCLW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |