C16H13FN2OS — CID 79127403
4-fluoro-2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]aniline (PubChem CID 79127403) has the molecular formula C16H13FN2OS and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-fluoro-2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]aniline.
| Compound Name | 4-fluoro-2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79127403 |
| Molecular Formula | C16H13FN2OS |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-fluoro-2-[(2-phenyl-1,3-oxazol-4-yl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(F)cc1SCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13FN2OS/c17-12-6-7-14(18)15(8-12)21-10-13-9-20-16(19-13)11-4-2-1-3-5-11/h1-9H,10,18H2 |
| InChIKey | FNLDTTOHZNAQJT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|