C10H10FN3S2 — CID 79147621
4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-amine (PubChem CID 79147621) has the molecular formula C10H10FN3S2 and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79147621 |
| Molecular Formula | C10H10FN3S2 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(CSc2cc(F)ccc2N)cs1 |
| InChI | InChI=1S/C10H10FN3S2/c11-6-1-2-8(12)9(3-6)15-4-7-5-16-10(13)14-7/h1-3,5H,4,12H2,(H2,13,14) |
| InChIKey | YUVATCYLINOBNR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|