C17H26N2OS — CID 79128184
2-(3-amino-2-methylphenyl)sulfanyl-N-cyclohexyl-N-ethylacetamide (PubChem CID 79128184) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 2-(3-amino-2-methylphenyl)sulfanyl-N-cyclohexyl-N-ethylacetamide.
| Compound Name | 2-(3-amino-2-methylphenyl)sulfanyl-N-cyclohexyl-N-ethylacetamide |
|---|---|
| PubChem CID | 79128184 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-(3-amino-2-methylphenyl)sulfanyl-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)CSc1cccc(N)c1C)C1CCCCC1 |
| InChI | InChI=1S/C17H26N2OS/c1-3-19(14-8-5-4-6-9-14)17(20)12-21-16-11-7-10-15(18)13(16)2/h7,10-11,14H,3-6,8-9,12,18H2,1-2H3 |
| InChIKey | LKZRZKSGPCEXSQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|