C15H15BrFNO2S — CID 79128352
2-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-4-fluoroaniline (PubChem CID 79128352) has the molecular formula C15H15BrFNO2S and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-4-fluoroaniline.
| Compound Name | 2-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 79128352 |
| Molecular Formula | C15H15BrFNO2S |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-4-fluoroaniline |
| SMILES | COc1cc(CSc2cc(F)ccc2N)c(OC)cc1Br |
| InChI | InChI=1S/C15H15BrFNO2S/c1-19-13-7-11(16)14(20-2)5-9(13)8-21-15-6-10(17)3-4-12(15)18/h3-7H,8,18H2,1-2H3 |
| InChIKey | OSNVGIHSUVHIRH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|