C14H11BrFNO2S — CID 102765890
4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-3-bromobenzoic acid (PubChem CID 102765890) has the molecular formula C14H11BrFNO2S and a molecular weight of 356.22 g/mol. Its IUPAC name is 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-3-bromobenzoic acid.
| Compound Name | 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-3-bromobenzoic acid |
|---|---|
| PubChem CID | 102765890 |
| Molecular Formula | C14H11BrFNO2S |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 4-[(2-amino-5-fluorophenyl)sulfanylmethyl]-3-bromobenzoic acid |
| SMILES | Nc1ccc(F)cc1SCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C14H11BrFNO2S/c15-11-5-8(14(18)19)1-2-9(11)7-20-13-6-10(16)3-4-12(13)17/h1-6H,7,17H2,(H,18,19) |
| InChIKey | BUFOHEJVRZMQEU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|