C14H21NO — CID 79128658
2-(1-amino-2-methylbutan-2-yl)-1,3-dihydroinden-2-ol (PubChem CID 79128658) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(1-amino-2-methylbutan-2-yl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(1-amino-2-methylbutan-2-yl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 79128658 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-(1-amino-2-methylbutan-2-yl)-1,3-dihydroinden-2-ol |
| SMILES | CCC(C)(CN)C1(O)Cc2ccccc2C1 |
| InChI | InChI=1S/C14H21NO/c1-3-13(2,10-15)14(16)8-11-6-4-5-7-12(11)9-14/h4-7,16H,3,8-10,15H2,1-2H3 |
| InChIKey | JNPPGULHVMZYDQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |