C12H9F7O — CID 151156434
2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dihydroinden-2-ol (PubChem CID 151156434) has the molecular formula C12H9F7O and a molecular weight of 302.19 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 151156434 |
| Molecular Formula | C12H9F7O |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)F)Cc2ccccc2C1 |
| InChI | InChI=1S/C12H9F7O/c13-10(14,11(15,16)12(17,18)19)9(20)5-7-3-1-2-4-8(7)6-9/h1-4,20H,5-6H2 |
| InChIKey | MZINMQIYSLVILF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|