C26H9AsF28O3 — CID 139137888
3,3,3',3'-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-1,1'-spirobi[2,1λ5-benzoxarsole] (PubChem CID 139137888) has the molecular formula C26H9AsF28O3 and a molecular weight of 976.22 g/mol. Its IUPAC name is 3,3,3',3'-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-1,1'-spirobi[2,1λ5-benzoxarsole].
| Compound Name | 3,3,3',3'-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-1,1'-spirobi[2,1λ5-benzoxarsole] |
|---|---|
| PubChem CID | 139137888 |
| Molecular Formula | C26H9AsF28O3 |
| Molecular Weight | 976.22 g/mol |
| Exact Mass | 975.93 |
| IUPAC Name | 3,3,3',3'-tetrakis(1,1,2,2,3,3,3-heptafluoropropyl)-1-hydroxy-1,1'-spirobi[2,1λ5-benzoxarsole] |
| SMILES | O[As]12(OC(C(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)F)c3ccccc31)OC(C(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)C(F)(F)F)c1ccccc12 |
| InChI | InChI=1S/C26H9AsF28O3/c28-15(29,19(36,37)23(44,45)46)13(16(30,31)20(38,39)24(47,48)49)9-5-1-3-7-11(9)27(56,57-13)12-8-4-2-6-10(12)14(58-27,17(32,33)21(40,41)25(50,51)52)18(34,35)22(42,43)26(53,54)55/h1-8,56H |
| InChIKey | INGPBFCUKJBOBI-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.22 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|