C31H14F20O2 — CID 132961636
6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-13-(trifluoromethyl)pentacene-6,13-diol (PubChem CID 132961636) has the molecular formula C31H14F20O2 and a molecular weight of 798.41 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-13-(trifluoromethyl)pentacene-6,13-diol.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-13-(trifluoromethyl)pentacene-6,13-diol |
|---|---|
| PubChem CID | 132961636 |
| Molecular Formula | C31H14F20O2 |
| Molecular Weight | 798.41 g/mol |
| Exact Mass | 798.07 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-13-(trifluoromethyl)pentacene-6,13-diol |
| SMILES | OC1(C(F)(F)F)c2cc3ccccc3cc2C(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C31H14F20O2/c32-23(33,24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)31(49,50)51)21(52)17-9-13-5-1-3-7-15(13)11-19(17)22(53,30(46,47)48)20-12-16-8-4-2-6-14(16)10-18(20)21/h1-12,52-53H |
| InChIKey | SLDABUVXBTYODH-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.41 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|