C16H9F15O — CID 150258584
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3-dihydroinden-2-ol (PubChem CID 150258584) has the molecular formula C16H9F15O and a molecular weight of 502.22 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 150258584 |
| Molecular Formula | C16H9F15O |
| Molecular Weight | 502.22 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Cc2ccccc2C1 |
| InChI | InChI=1S/C16H9F15O/c17-10(18,9(32)5-7-3-1-2-4-8(7)6-9)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-4,32H,5-6H2 |
| InChIKey | GBBOHQQIDQMUKL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.22 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|